C16H15Cl2FO — CID 114833275
1-(2,4-dichlorophenyl)-3-(3-fluorophenyl)-2-methylpropan-2-ol (PubChem CID 114833275) has the molecular formula C16H15Cl2FO and a molecular weight of 313.20 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(3-fluorophenyl)-2-methylpropan-2-ol.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(3-fluorophenyl)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 114833275 |
| Molecular Formula | C16H15Cl2FO |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(3-fluorophenyl)-2-methylpropan-2-ol |
| SMILES | CC(O)(Cc1cccc(F)c1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl2FO/c1-16(20,9-11-3-2-4-14(19)7-11)10-12-5-6-13(17)8-15(12)18/h2-8,20H,9-10H2,1H3 |
| InChIKey | VHBFAHXORZYOTL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |