C16H10Br4Cl4O2S — CID 87151632
2,4-dichloro-1-[2,2-dibromo-2-[1,1-dibromo-2-(2,4-dichlorophenyl)ethyl]sulfonylethyl]benzene (PubChem CID 87151632) has the molecular formula C16H10Br4Cl4O2S and a molecular weight of 727.75 g/mol. Its IUPAC name is 2,4-dichloro-1-[2,2-dibromo-2-[1,1-dibromo-2-(2,4-dichlorophenyl)ethyl]sulfonylethyl]benzene.
| Compound Name | 2,4-dichloro-1-[2,2-dibromo-2-[1,1-dibromo-2-(2,4-dichlorophenyl)ethyl]sulfonylethyl]benzene |
|---|---|
| PubChem CID | 87151632 |
| Molecular Formula | C16H10Br4Cl4O2S |
| Molecular Weight | 727.75 g/mol |
| Exact Mass | 721.59 |
| IUPAC Name | 2,4-dichloro-1-[2,2-dibromo-2-[1,1-dibromo-2-(2,4-dichlorophenyl)ethyl]sulfonylethyl]benzene |
| SMILES | O=S(=O)(C(Br)(Br)Cc1ccc(Cl)cc1Cl)C(Br)(Br)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Br4Cl4O2S/c17-15(18,7-9-1-3-11(21)5-13(9)23)27(25,26)16(19,20)8-10-2-4-12(22)6-14(10)24/h1-6H,7-8H2 |
| InChIKey | ASZOXXYBLZODEX-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.75 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|