C19H20Cl3N3O3 — CID 146388370
tert-butyl N-[[2-chloro-6-[(3,4-dichlorophenyl)methylcarbamoyl]-4-pyridinyl]methyl]carbamate (PubChem CID 146388370) has the molecular formula C19H20Cl3N3O3 and a molecular weight of 444.75 g/mol. Its IUPAC name is tert-butyl N-[[2-chloro-6-[(3,4-dichlorophenyl)methylcarbamoyl]-4-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-chloro-6-[(3,4-dichlorophenyl)methylcarbamoyl]-4-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 146388370 |
| Molecular Formula | C19H20Cl3N3O3 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | tert-butyl N-[[2-chloro-6-[(3,4-dichlorophenyl)methylcarbamoyl]-4-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(Cl)nc(C(=O)NCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H20Cl3N3O3/c1-19(2,3)28-18(27)24-10-12-7-15(25-16(22)8-12)17(26)23-9-11-4-5-13(20)14(21)6-11/h4-8H,9-10H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | IOJPCMACGFDDJJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|