C23H27Cl2N5O3 — CID 67265860
tert-butyl (3aS,6aR)-2-[6-[(3,4-dichlorophenyl)methylcarbamoyl]pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 67265860) has the molecular formula C23H27Cl2N5O3 and a molecular weight of 492.41 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-2-[6-[(3,4-dichlorophenyl)methylcarbamoyl]pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-2-[6-[(3,4-dichlorophenyl)methylcarbamoyl]pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 67265860 |
| Molecular Formula | C23H27Cl2N5O3 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | tert-butyl (3aS,6aR)-2-[6-[(3,4-dichlorophenyl)methylcarbamoyl]pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CN(c3cncc(C(=O)NCc4ccc(Cl)c(Cl)c4)n3)C[C@@H]2C1 |
| InChI | InChI=1S/C23H27Cl2N5O3/c1-23(2,3)33-22(32)30-12-15-10-29(11-16(15)13-30)20-9-26-8-19(28-20)21(31)27-7-14-4-5-17(24)18(25)6-14/h4-6,8-9,15-16H,7,10-13H2,1-3H3,(H,27,31)/t15-,16+ |
| InChIKey | MHCXSZFRHCEJTM-IYBDPMFKSA-N |
| XLogP | 4.02 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |