C20H23Cl2N3O3 — CID 153453641
tert-butyl N-[[2-chloro-6-[(4-chloro-3-methylphenyl)methylcarbamoyl]-4-pyridinyl]methyl]carbamate (PubChem CID 153453641) has the molecular formula C20H23Cl2N3O3 and a molecular weight of 424.33 g/mol. Its IUPAC name is tert-butyl N-[[2-chloro-6-[(4-chloro-3-methylphenyl)methylcarbamoyl]-4-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-chloro-6-[(4-chloro-3-methylphenyl)methylcarbamoyl]-4-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 153453641 |
| Molecular Formula | C20H23Cl2N3O3 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | tert-butyl N-[[2-chloro-6-[(4-chloro-3-methylphenyl)methylcarbamoyl]-4-pyridinyl]methyl]carbamate |
| SMILES | Cc1cc(CNC(=O)c2cc(CNC(=O)OC(C)(C)C)cc(Cl)n2)ccc1Cl |
| InChI | InChI=1S/C20H23Cl2N3O3/c1-12-7-13(5-6-15(12)21)10-23-18(26)16-8-14(9-17(22)25-16)11-24-19(27)28-20(2,3)4/h5-9H,10-11H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | KAYQLEIRSOUXCS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|