C22H19BrClFN2O — CID 146457797
4-(bromomethyl)-N-[(4-chloro-3-methylphenyl)methyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide (PubChem CID 146457797) has the molecular formula C22H19BrClFN2O and a molecular weight of 461.76 g/mol. Its IUPAC name is 4-(bromomethyl)-N-[(4-chloro-3-methylphenyl)methyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide.
| Compound Name | 4-(bromomethyl)-N-[(4-chloro-3-methylphenyl)methyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146457797 |
| Molecular Formula | C22H19BrClFN2O |
| Molecular Weight | 461.76 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 4-(bromomethyl)-N-[(4-chloro-3-methylphenyl)methyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(CBr)cc(-c3ccc(F)cc3C)n2)ccc1Cl |
| InChI | InChI=1S/C22H19BrClFN2O/c1-13-8-17(25)4-5-18(13)20-9-16(11-23)10-21(27-20)22(28)26-12-15-3-6-19(24)14(2)7-15/h3-10H,11-12H2,1-2H3,(H,26,28) |
| InChIKey | YAOUSPXATWOROY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.76 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|