C22H16BrCl2F2NO — CID 146456239
3-(bromomethyl)-N-[(3,4-dichlorophenyl)methyl]-5-(2,4-difluoro-6-methylphenyl)benzamide (PubChem CID 146456239) has the molecular formula C22H16BrCl2F2NO and a molecular weight of 499.18 g/mol. Its IUPAC name is 3-(bromomethyl)-N-[(3,4-dichlorophenyl)methyl]-5-(2,4-difluoro-6-methylphenyl)benzamide.
| Compound Name | 3-(bromomethyl)-N-[(3,4-dichlorophenyl)methyl]-5-(2,4-difluoro-6-methylphenyl)benzamide |
|---|---|
| PubChem CID | 146456239 |
| Molecular Formula | C22H16BrCl2F2NO |
| Molecular Weight | 499.18 g/mol |
| Exact Mass | 496.98 |
| IUPAC Name | 3-(bromomethyl)-N-[(3,4-dichlorophenyl)methyl]-5-(2,4-difluoro-6-methylphenyl)benzamide |
| SMILES | Cc1cc(F)cc(F)c1-c1cc(CBr)cc(C(=O)NCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C22H16BrCl2F2NO/c1-12-4-17(26)9-20(27)21(12)15-5-14(10-23)6-16(8-15)22(29)28-11-13-2-3-18(24)19(25)7-13/h2-9H,10-11H2,1H3,(H,28,29) |
| InChIKey | NIGUFLRJSYHHEL-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.18 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|