C21H18Cl2FN3O — CID 146370787
3-(aminomethyl)-N-[(3,4-dichlorophenyl)methyl]-5-(6-fluoro-2-methyl-3-pyridinyl)benzamide (PubChem CID 146370787) has the molecular formula C21H18Cl2FN3O and a molecular weight of 418.30 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[(3,4-dichlorophenyl)methyl]-5-(6-fluoro-2-methyl-3-pyridinyl)benzamide.
| Compound Name | 3-(aminomethyl)-N-[(3,4-dichlorophenyl)methyl]-5-(6-fluoro-2-methyl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 146370787 |
| Molecular Formula | C21H18Cl2FN3O |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 3-(aminomethyl)-N-[(3,4-dichlorophenyl)methyl]-5-(6-fluoro-2-methyl-3-pyridinyl)benzamide |
| SMILES | Cc1nc(F)ccc1-c1cc(CN)cc(C(=O)NCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C21H18Cl2FN3O/c1-12-17(3-5-20(24)27-12)15-6-14(10-25)7-16(9-15)21(28)26-11-13-2-4-18(22)19(23)8-13/h2-9H,10-11,25H2,1H3,(H,26,28) |
| InChIKey | HEDIZGOCQMOFHP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|