C25H25BrFNO3 — CID 146456107
3-(bromomethyl)-N-[(3,5-dimethoxyphenyl)methyl]-5-(4-fluoro-2,6-dimethylphenyl)benzamide (PubChem CID 146456107) has the molecular formula C25H25BrFNO3 and a molecular weight of 486.38 g/mol. Its IUPAC name is 3-(bromomethyl)-N-[(3,5-dimethoxyphenyl)methyl]-5-(4-fluoro-2,6-dimethylphenyl)benzamide.
| Compound Name | 3-(bromomethyl)-N-[(3,5-dimethoxyphenyl)methyl]-5-(4-fluoro-2,6-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 146456107 |
| Molecular Formula | C25H25BrFNO3 |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 3-(bromomethyl)-N-[(3,5-dimethoxyphenyl)methyl]-5-(4-fluoro-2,6-dimethylphenyl)benzamide |
| SMILES | COc1cc(CNC(=O)c2cc(CBr)cc(-c3c(C)cc(F)cc3C)c2)cc(OC)c1 |
| InChI | InChI=1S/C25H25BrFNO3/c1-15-5-21(27)6-16(2)24(15)19-7-17(13-26)8-20(11-19)25(29)28-14-18-9-22(30-3)12-23(10-18)31-4/h5-12H,13-14H2,1-4H3,(H,28,29) |
| InChIKey | UHBQFVJPIJWPTI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|