C21H16BrCl2FN2O — CID 146456811
4-(bromomethyl)-N-[(3,4-dichlorophenyl)methyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide (PubChem CID 146456811) has the molecular formula C21H16BrCl2FN2O and a molecular weight of 482.18 g/mol. Its IUPAC name is 4-(bromomethyl)-N-[(3,4-dichlorophenyl)methyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide.
| Compound Name | 4-(bromomethyl)-N-[(3,4-dichlorophenyl)methyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146456811 |
| Molecular Formula | C21H16BrCl2FN2O |
| Molecular Weight | 482.18 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | 4-(bromomethyl)-N-[(3,4-dichlorophenyl)methyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(F)ccc1-c1cc(CBr)cc(C(=O)NCc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C21H16BrCl2FN2O/c1-12-6-15(25)3-4-16(12)19-8-14(10-22)9-20(27-19)21(28)26-11-13-2-5-17(23)18(24)7-13/h2-9H,10-11H2,1H3,(H,26,28) |
| InChIKey | UHOWLUHEMSQXJG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.18 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|