C22H18BrCl2FN2O — CID 146456188
4-(bromomethyl)-N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide (PubChem CID 146456188) has the molecular formula C22H18BrCl2FN2O and a molecular weight of 496.21 g/mol. Its IUPAC name is 4-(bromomethyl)-N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide.
| Compound Name | 4-(bromomethyl)-N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146456188 |
| Molecular Formula | C22H18BrCl2FN2O |
| Molecular Weight | 496.21 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | 4-(bromomethyl)-N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-6-(4-fluoro-2-methylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(F)ccc1-c1cc(CBr)cc(C(=O)N[C@H](C)c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C22H18BrCl2FN2O/c1-12-7-16(26)4-5-17(12)20-8-14(11-23)9-21(28-20)22(29)27-13(2)15-3-6-18(24)19(25)10-15/h3-10,13H,11H2,1-2H3,(H,27,29)/t13-/m1/s1 |
| InChIKey | YDBREJCYDVJGOG-CYBMUJFWSA-N |
| XLogP | 6.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.21 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|