C18H14Cl2N2O — CID 9467467
N-[(1R)-1-(3,4-dichlorophenyl)ethyl]quinoline-2-carboxamide (PubChem CID 9467467) has the molecular formula C18H14Cl2N2O and a molecular weight of 345.23 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dichlorophenyl)ethyl]quinoline-2-carboxamide.
| Compound Name | N-[(1R)-1-(3,4-dichlorophenyl)ethyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 9467467 |
| Molecular Formula | C18H14Cl2N2O |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N-[(1R)-1-(3,4-dichlorophenyl)ethyl]quinoline-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2ccccc2n1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N2O/c1-11(13-6-8-14(19)15(20)10-13)21-18(23)17-9-7-12-4-2-3-5-16(12)22-17/h2-11H,1H3,(H,21,23)/t11-/m1/s1 |
| InChIKey | LYLDRTYIMFROMC-LLVKDONJSA-N |
| XLogP | 5.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |