C20H20N2O2 — CID 9262198
N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]quinoline-2-carboxamide (PubChem CID 9262198) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]quinoline-2-carboxamide.
| Compound Name | N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 9262198 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]quinoline-2-carboxamide |
| SMILES | COc1ccc(C)cc1[C@@H](C)NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H20N2O2/c1-13-8-11-19(24-3)16(12-13)14(2)21-20(23)18-10-9-15-6-4-5-7-17(15)22-18/h4-12,14H,1-3H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | NMUHTANVQMERBF-CQSZACIVSA-N |
| XLogP | 4.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |