C21H34O4Si — CID 169432229
tert-butyl (E)-3-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxyphenyl]prop-2-enoate (PubChem CID 169432229) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is tert-butyl (E)-3-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxyphenyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 169432229 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | tert-butyl (E)-3-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cccc(CO[Si](C)(C)C(C)(C)C)c1/C=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34O4Si/c1-20(2,3)25-19(22)14-13-17-16(11-10-12-18(17)23-7)15-24-26(8,9)21(4,5)6/h10-14H,15H2,1-9H3/b14-13+ |
| InChIKey | KYKSNTSLRCEUIQ-BUHFOSPRSA-N |
| XLogP | 5.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|