C21H32O4 — CID 132937386
tert-butyl (E)-3-[2-methoxy-6-(1-methoxyhexan-2-yl)phenyl]prop-2-enoate (PubChem CID 132937386) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is tert-butyl (E)-3-[2-methoxy-6-(1-methoxyhexan-2-yl)phenyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[2-methoxy-6-(1-methoxyhexan-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 132937386 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | tert-butyl (E)-3-[2-methoxy-6-(1-methoxyhexan-2-yl)phenyl]prop-2-enoate |
| SMILES | CCCCC(COC)c1cccc(OC)c1/C=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32O4/c1-7-8-10-16(15-23-5)17-11-9-12-19(24-6)18(17)13-14-20(22)25-21(2,3)4/h9,11-14,16H,7-8,10,15H2,1-6H3/b14-13+ |
| InChIKey | DICNMDBVMYHIRH-BUHFOSPRSA-N |
| XLogP | 4.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|