C19H30O3Si — CID 15532514
tert-butyl-[[3-methoxy-2-[(1Z)-1-methoxybuta-1,3-dienyl]phenyl]methoxy]-dimethylsilane (PubChem CID 15532514) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is tert-butyl-[[3-methoxy-2-[(1Z)-1-methoxybuta-1,3-dienyl]phenyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[3-methoxy-2-[(1Z)-1-methoxybuta-1,3-dienyl]phenyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 15532514 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | tert-butyl-[[3-methoxy-2-[(1Z)-1-methoxybuta-1,3-dienyl]phenyl]methoxy]-dimethylsilane |
| SMILES | C=C/C=C(\OC)c1c(CO[Si](C)(C)C(C)(C)C)cccc1OC |
| InChI | InChI=1S/C19H30O3Si/c1-9-11-16(20-5)18-15(12-10-13-17(18)21-6)14-22-23(7,8)19(2,3)4/h9-13H,1,14H2,2-8H3/b16-11- |
| InChIKey | KOKQKTZHVHCXPV-WJDWOHSUSA-N |
| XLogP | 5.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|