C29H46BFO2Si — CID 157285347
tert-butyl-dimethyl-[(3-methyl-2-prop-2-enylphenyl)methoxy]silane;fluoro-methyl-tritioborane;(3-methyl-2-prop-2-enylphenyl)methanol (PubChem CID 157285347) has the molecular formula C29H46BFO2Si and a molecular weight of 486.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3-methyl-2-prop-2-enylphenyl)methoxy]silane;fluoro-methyl-tritioborane;(3-methyl-2-prop-2-enylphenyl)methanol.
| Compound Name | tert-butyl-dimethyl-[(3-methyl-2-prop-2-enylphenyl)methoxy]silane;fluoro-methyl-tritioborane;(3-methyl-2-prop-2-enylphenyl)methanol |
|---|---|
| PubChem CID | 157285347 |
| Molecular Formula | C29H46BFO2Si |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | tert-butyl-dimethyl-[(3-methyl-2-prop-2-enylphenyl)methoxy]silane;fluoro-methyl-tritioborane;(3-methyl-2-prop-2-enylphenyl)methanol |
| SMILES | C=CCc1c(C)cccc1CO.C=CCc1c(C)cccc1CO[Si](C)(C)C(C)(C)C.[3H]B(C)F |
| InChI | InChI=1S/C17H28OSi.C11H14O.CH4BF/c1-8-10-16-14(2)11-9-12-15(16)13-18-19(6,7)17(3,4)5;1-3-5-11-9(2)6-4-7-10(11)8-12;1-2-3/h8-9,11-12H,1,10,13H2,2-7H3;3-4,6-7,12H,1,5,8H2,2H3;2H,1H3/i;;2T |
| InChIKey | BADYMVPGXYKFQN-IRKISQMASA-N |
| XLogP | 7.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|