C15H23NO2SSi — CID 151132328
[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-benzothiazol-7-yl]methanol (PubChem CID 151132328) has the molecular formula C15H23NO2SSi and a molecular weight of 309.51 g/mol. Its IUPAC name is [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-benzothiazol-7-yl]methanol.
| Compound Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-benzothiazol-7-yl]methanol |
|---|---|
| PubChem CID | 151132328 |
| Molecular Formula | C15H23NO2SSi |
| Molecular Weight | 309.51 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-benzothiazol-7-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1nc2cccc(CO)c2s1 |
| InChI | InChI=1S/C15H23NO2SSi/c1-15(2,3)20(4,5)18-10-13-16-12-8-6-7-11(9-17)14(12)19-13/h6-8,17H,9-10H2,1-5H3 |
| InChIKey | MUMHNAMCQZPCKC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|