C23H23NO2 — CID 51356016
tert-butyl N-[4-[2-(2-phenylethynyl)phenyl]but-3-ynyl]carbamate (PubChem CID 51356016) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(2-phenylethynyl)phenyl]but-3-ynyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(2-phenylethynyl)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 51356016 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | tert-butyl N-[4-[2-(2-phenylethynyl)phenyl]but-3-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC#Cc1ccccc1C#Cc1ccccc1 |
| InChI | InChI=1S/C23H23NO2/c1-23(2,3)26-22(25)24-18-10-9-15-20-13-7-8-14-21(20)17-16-19-11-5-4-6-12-19/h4-8,11-14H,10,18H2,1-3H3,(H,24,25) |
| InChIKey | HROUXLVVUCHVNZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|