C15H19N3O4 — CID 118417938
tert-butyl N-[4-(2-amino-4-nitrophenyl)but-3-ynyl]carbamate (PubChem CID 118417938) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is tert-butyl N-[4-(2-amino-4-nitrophenyl)but-3-ynyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-amino-4-nitrophenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 118417938 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | tert-butyl N-[4-(2-amino-4-nitrophenyl)but-3-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC#Cc1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C15H19N3O4/c1-15(2,3)22-14(19)17-9-5-4-6-11-7-8-12(18(20)21)10-13(11)16/h7-8,10H,5,9,16H2,1-3H3,(H,17,19) |
| InChIKey | HFVADJXECVRPGM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|