C23H22N2O5 — CID 155579299
tert-butyl N-[3-[2-[(1,3-dioxo-4H-isoquinolin-8-yl)oxy]phenyl]prop-2-ynyl]carbamate (PubChem CID 155579299) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[(1,3-dioxo-4H-isoquinolin-8-yl)oxy]phenyl]prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[(1,3-dioxo-4H-isoquinolin-8-yl)oxy]phenyl]prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 155579299 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | tert-butyl N-[3-[2-[(1,3-dioxo-4H-isoquinolin-8-yl)oxy]phenyl]prop-2-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC#Cc1ccccc1Oc1cccc2c1C(=O)NC(=O)C2 |
| InChI | InChI=1S/C23H22N2O5/c1-23(2,3)30-22(28)24-13-7-10-15-8-4-5-11-17(15)29-18-12-6-9-16-14-19(26)25-21(27)20(16)18/h4-6,8-9,11-12H,13-14H2,1-3H3,(H,24,28)(H,25,26,27) |
| InChIKey | UCFXDSZTOHOPCH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|