C25H24N2O6 — CID 164939870
tert-butyl N-[5-[4-(1,3,4-trioxoisoquinolin-8-yl)oxyphenyl]pent-4-ynyl]carbamate (PubChem CID 164939870) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is tert-butyl N-[5-[4-(1,3,4-trioxoisoquinolin-8-yl)oxyphenyl]pent-4-ynyl]carbamate.
| Compound Name | tert-butyl N-[5-[4-(1,3,4-trioxoisoquinolin-8-yl)oxyphenyl]pent-4-ynyl]carbamate |
|---|---|
| PubChem CID | 164939870 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | tert-butyl N-[5-[4-(1,3,4-trioxoisoquinolin-8-yl)oxyphenyl]pent-4-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC#Cc1ccc(Oc2cccc3c2C(=O)NC(=O)C3=O)cc1 |
| InChI | InChI=1S/C25H24N2O6/c1-25(2,3)33-24(31)26-15-6-4-5-8-16-11-13-17(14-12-16)32-19-10-7-9-18-20(19)22(29)27-23(30)21(18)28/h7,9-14H,4,6,15H2,1-3H3,(H,26,31)(H,27,29,30) |
| InChIKey | NFNYLQTUQKCCSP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|