C27H34N2O5 — CID 155579304
tert-butyl N-[7-[2-[(1,3-dioxo-4H-isoquinolin-8-yl)oxy]phenyl]heptyl]carbamate (PubChem CID 155579304) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is tert-butyl N-[7-[2-[(1,3-dioxo-4H-isoquinolin-8-yl)oxy]phenyl]heptyl]carbamate.
| Compound Name | tert-butyl N-[7-[2-[(1,3-dioxo-4H-isoquinolin-8-yl)oxy]phenyl]heptyl]carbamate |
|---|---|
| PubChem CID | 155579304 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | tert-butyl N-[7-[2-[(1,3-dioxo-4H-isoquinolin-8-yl)oxy]phenyl]heptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCc1ccccc1Oc1cccc2c1C(=O)NC(=O)C2 |
| InChI | InChI=1S/C27H34N2O5/c1-27(2,3)34-26(32)28-17-10-6-4-5-7-12-19-13-8-9-15-21(19)33-22-16-11-14-20-18-23(30)29-25(31)24(20)22/h8-9,11,13-16H,4-7,10,12,17-18H2,1-3H3,(H,28,32)(H,29,30,31) |
| InChIKey | JIRPUPXWMKHJKT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|