C14H28BrNO2 — CID 166705207
tert-butyl N-(5-bromo-3,3,5-trimethylhexyl)carbamate (PubChem CID 166705207) has the molecular formula C14H28BrNO2 and a molecular weight of 322.29 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-3,3,5-trimethylhexyl)carbamate.
| Compound Name | tert-butyl N-(5-bromo-3,3,5-trimethylhexyl)carbamate |
|---|---|
| PubChem CID | 166705207 |
| Molecular Formula | C14H28BrNO2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | tert-butyl N-(5-bromo-3,3,5-trimethylhexyl)carbamate |
| SMILES | CC(C)(Br)CC(C)(C)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28BrNO2/c1-12(2,3)18-11(17)16-9-8-13(4,5)10-14(6,7)15/h8-10H2,1-7H3,(H,16,17) |
| InChIKey | VIPKYNIKWNMXIV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|