C10H19BrN2O2 — CID 115614738
tert-butyl N-[2-(2-bromoprop-2-enylamino)ethyl]carbamate (PubChem CID 115614738) has the molecular formula C10H19BrN2O2 and a molecular weight of 279.18 g/mol. Its IUPAC name is tert-butyl N-[2-(2-bromoprop-2-enylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-bromoprop-2-enylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 115614738 |
| Molecular Formula | C10H19BrN2O2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | tert-butyl N-[2-(2-bromoprop-2-enylamino)ethyl]carbamate |
| SMILES | C=C(Br)CNCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19BrN2O2/c1-8(11)7-12-5-6-13-9(14)15-10(2,3)4/h12H,1,5-7H2,2-4H3,(H,13,14) |
| InChIKey | AMGZNBFZLYXEFP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|