C12H25N3O3 — CID 112688735
tert-butyl N-[2-[[1-(ethylamino)-1-oxopropan-2-yl]amino]ethyl]carbamate (PubChem CID 112688735) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(ethylamino)-1-oxopropan-2-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(ethylamino)-1-oxopropan-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 112688735 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | tert-butyl N-[2-[[1-(ethylamino)-1-oxopropan-2-yl]amino]ethyl]carbamate |
| SMILES | CCNC(=O)C(C)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25N3O3/c1-6-13-10(16)9(2)14-7-8-15-11(17)18-12(3,4)5/h9,14H,6-8H2,1-5H3,(H,13,16)(H,15,17) |
| InChIKey | YOXVBGHKYYNXMI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|