About 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate
4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate (PubChem CID 159236421) has the molecular formula C14H28O4SSi
and a molecular weight of 320.53 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate |
| PubChem CID | 159236421 |
| Molecular Formula | C14H28O4SSi |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CS)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C14H28O4SSi/c1-14(2,3)18-12(15)9-11(10-19)13(16)17-7-8-20(4,5)6/h11,19H,7-10H2,1-6H3/t11-/m0/s1 |
| InChIKey | KTNLBEGGLCBVLU-NSHDSACASA-N |
| XLogP | 3.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate?
The IUPAC name of 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate (CID 159236421) is 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate.
What is the SMILES notation for 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate?
The canonical SMILES for 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate is CC(C)(C)OC(=O)C[C@@H](CS)C(=O)OCC[Si](C)(C)C.
What is the InChIKey of 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate?
The InChIKey is KTNLBEGGLCBVLU-NSHDSACASA-N. The full InChI is InChI=1S/C14H28O4SSi/c1-14(2,3)18-12(15)9-11(10-19)13(16)17-7-8-20(4,5)6/h11,19H,7-10H2,1-6H3/t11-/m0/s1.
What are the key properties of 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate?
4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate has a molecular weight of 320.53 g/mol, XLogP of 3.15, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-(2-trimethylsilylethyl) (2R)-2-(sulfanylmethyl)butanedioate is sourced from PubChem (CID 159236421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).