C24H38N2O5Si — CID 69072989
4-O-tert-butyl 1-O-methyl 2-[[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]methyl]butanedioate (PubChem CID 69072989) has the molecular formula C24H38N2O5Si and a molecular weight of 462.66 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl 2-[[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]methyl]butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl 2-[[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]methyl]butanedioate |
|---|---|
| PubChem CID | 69072989 |
| Molecular Formula | C24H38N2O5Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl 2-[[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]methyl]butanedioate |
| SMILES | COC(=O)C(CC(=O)OC(C)(C)C)Cc1cc(C)c2nn(COCC[Si](C)(C)C)cc2c1 |
| InChI | InChI=1S/C24H38N2O5Si/c1-17-11-18(12-19(23(28)29-5)14-21(27)31-24(2,3)4)13-20-15-26(25-22(17)20)16-30-9-10-32(6,7)8/h11,13,15,19H,9-10,12,14,16H2,1-8H3 |
| InChIKey | RDFXVYXHPBYCJQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|