C26H34N6O3Si — CID 69064695
[2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]-1-[1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl]carbamic acid (PubChem CID 69064695) has the molecular formula C26H34N6O3Si and a molecular weight of 506.68 g/mol. Its IUPAC name is [2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]-1-[1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl]carbamic acid.
| Compound Name | [2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]-1-[1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 69064695 |
| Molecular Formula | C26H34N6O3Si |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | [2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]-1-[1-(pyridin-2-ylmethyl)imidazol-2-yl]ethyl]carbamic acid |
| SMILES | Cc1cc(CC(NC(=O)O)c2nccn2Cc2ccccn2)cc2cn(COCC[Si](C)(C)C)nc12 |
| InChI | InChI=1S/C26H34N6O3Si/c1-19-13-20(14-21-16-32(30-24(19)21)18-35-11-12-36(2,3)4)15-23(29-26(33)34)25-28-9-10-31(25)17-22-7-5-6-8-27-22/h5-10,13-14,16,23,29H,11-12,15,17-18H2,1-4H3,(H,33,34) |
| InChIKey | YWFKLVCUDPUTKB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|