C27H35ClN6O3Si — CID 87679960
[1-[1-[(2-chloro-6-methyl-4-pyridinyl)methyl]imidazol-2-yl]-2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]ethyl]carbamic acid (PubChem CID 87679960) has the molecular formula C27H35ClN6O3Si and a molecular weight of 555.16 g/mol. Its IUPAC name is [1-[1-[(2-chloro-6-methyl-4-pyridinyl)methyl]imidazol-2-yl]-2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]ethyl]carbamic acid.
| Compound Name | [1-[1-[(2-chloro-6-methyl-4-pyridinyl)methyl]imidazol-2-yl]-2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 87679960 |
| Molecular Formula | C27H35ClN6O3Si |
| Molecular Weight | 555.16 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | [1-[1-[(2-chloro-6-methyl-4-pyridinyl)methyl]imidazol-2-yl]-2-[7-methyl-2-(2-trimethylsilylethoxymethyl)indazol-5-yl]ethyl]carbamic acid |
| SMILES | Cc1cc(Cn2ccnc2C(Cc2cc(C)c3nn(COCC[Si](C)(C)C)cc3c2)NC(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C27H35ClN6O3Si/c1-18-10-20(12-22-16-34(32-25(18)22)17-37-8-9-38(3,4)5)13-23(31-27(35)36)26-29-6-7-33(26)15-21-11-19(2)30-24(28)14-21/h6-7,10-12,14,16,23,31H,8-9,13,15,17H2,1-5H3,(H,35,36) |
| InChIKey | ATHDANZBIDYIQI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.16 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|