C25H33NO6 — CID 102510524
benzyl N-[(1S,2S)-5-hydroxy-1-(1-methoxy-2-methylprop-1-enoxy)-2-phenylmethoxypentyl]carbamate (PubChem CID 102510524) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is benzyl N-[(1S,2S)-5-hydroxy-1-(1-methoxy-2-methylprop-1-enoxy)-2-phenylmethoxypentyl]carbamate.
| Compound Name | benzyl N-[(1S,2S)-5-hydroxy-1-(1-methoxy-2-methylprop-1-enoxy)-2-phenylmethoxypentyl]carbamate |
|---|---|
| PubChem CID | 102510524 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | benzyl N-[(1S,2S)-5-hydroxy-1-(1-methoxy-2-methylprop-1-enoxy)-2-phenylmethoxypentyl]carbamate |
| SMILES | COC(O[C@H](NC(=O)OCc1ccccc1)[C@H](CCCO)OCc1ccccc1)=C(C)C |
| InChI | InChI=1S/C25H33NO6/c1-19(2)24(29-3)32-23(26-25(28)31-18-21-13-8-5-9-14-21)22(15-10-16-27)30-17-20-11-6-4-7-12-20/h4-9,11-14,22-23,27H,10,15-18H2,1-3H3,(H,26,28)/t22-,23-/m0/s1 |
| InChIKey | URUGZXQUAQQQEP-GOTSBHOMSA-N |
| XLogP | 4.51 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|