C28H32O5 — CID 70649765
[(2R,3S)-1,3-bis(phenylmethoxy)pentan-2-yl] 2-phenylmethoxyacetate (PubChem CID 70649765) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is [(2R,3S)-1,3-bis(phenylmethoxy)pentan-2-yl] 2-phenylmethoxyacetate.
| Compound Name | [(2R,3S)-1,3-bis(phenylmethoxy)pentan-2-yl] 2-phenylmethoxyacetate |
|---|---|
| PubChem CID | 70649765 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | [(2R,3S)-1,3-bis(phenylmethoxy)pentan-2-yl] 2-phenylmethoxyacetate |
| SMILES | CC[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C28H32O5/c1-2-26(32-20-25-16-10-5-11-17-25)27(21-30-18-23-12-6-3-7-13-23)33-28(29)22-31-19-24-14-8-4-9-15-24/h3-17,26-27H,2,18-22H2,1H3/t26-,27+/m0/s1 |
| InChIKey | XFJVJKPQLHUPOP-RRPNLBNLSA-N |
| XLogP | 5.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |