C20H27ClO4 — CID 101202325
methyl (2E,4E,6R,7R,8S,9S)-7-chloro-6-hydroxy-6,8-dimethyl-9-phenylmethoxydeca-2,4-dienoate (PubChem CID 101202325) has the molecular formula C20H27ClO4 and a molecular weight of 366.89 g/mol. Its IUPAC name is methyl (2E,4E,6R,7R,8S,9S)-7-chloro-6-hydroxy-6,8-dimethyl-9-phenylmethoxydeca-2,4-dienoate.
| Compound Name | methyl (2E,4E,6R,7R,8S,9S)-7-chloro-6-hydroxy-6,8-dimethyl-9-phenylmethoxydeca-2,4-dienoate |
|---|---|
| PubChem CID | 101202325 |
| Molecular Formula | C20H27ClO4 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | methyl (2E,4E,6R,7R,8S,9S)-7-chloro-6-hydroxy-6,8-dimethyl-9-phenylmethoxydeca-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/[C@@](C)(O)[C@H](Cl)[C@@H](C)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C20H27ClO4/c1-15(16(2)25-14-17-10-6-5-7-11-17)19(21)20(3,23)13-9-8-12-18(22)24-4/h5-13,15-16,19,23H,14H2,1-4H3/b12-8+,13-9+/t15-,16-,19+,20+/m0/s1 |
| InChIKey | AOUFJOFTXRTXFC-FJOCTIQMSA-N |
| XLogP | 3.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|