C21H29NO7 — CID 11080038
methyl (Z,4S,5R)-5-acetamido-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-4-phenylmethoxypent-2-enoate (PubChem CID 11080038) has the molecular formula C21H29NO7 and a molecular weight of 407.46 g/mol. Its IUPAC name is methyl (Z,4S,5R)-5-acetamido-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-4-phenylmethoxypent-2-enoate.
| Compound Name | methyl (Z,4S,5R)-5-acetamido-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-4-phenylmethoxypent-2-enoate |
|---|---|
| PubChem CID | 11080038 |
| Molecular Formula | C21H29NO7 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | methyl (Z,4S,5R)-5-acetamido-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-4-phenylmethoxypent-2-enoate |
| SMILES | COC(=O)/C(=C/[C@H](OCc1ccccc1)[C@@H](NC(C)=O)[C@@H]1COC(C)(C)O1)OC |
| InChI | InChI=1S/C21H29NO7/c1-14(23)22-19(18-13-28-21(2,3)29-18)16(11-17(25-4)20(24)26-5)27-12-15-9-7-6-8-10-15/h6-11,16,18-19H,12-13H2,1-5H3,(H,22,23)/b17-11-/t16-,18-,19+/m0/s1 |
| InChIKey | XQDCGCDRBZNXPP-URJCDIQJSA-N |
| XLogP | 1.93 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|