C31H38O6 — CID 71271905
3-(2,2-dimethyl-1,1-diphenylpropoxy)-5-(2,3,4-trimethoxyphenyl)pentanoic acid (PubChem CID 71271905) has the molecular formula C31H38O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is 3-(2,2-dimethyl-1,1-diphenylpropoxy)-5-(2,3,4-trimethoxyphenyl)pentanoic acid.
| Compound Name | 3-(2,2-dimethyl-1,1-diphenylpropoxy)-5-(2,3,4-trimethoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 71271905 |
| Molecular Formula | C31H38O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 3-(2,2-dimethyl-1,1-diphenylpropoxy)-5-(2,3,4-trimethoxyphenyl)pentanoic acid |
| SMILES | COc1ccc(CCC(CC(=O)O)OC(c2ccccc2)(c2ccccc2)C(C)(C)C)c(OC)c1OC |
| InChI | InChI=1S/C31H38O6/c1-30(2,3)31(23-13-9-7-10-14-23,24-15-11-8-12-16-24)37-25(21-27(32)33)19-17-22-18-20-26(34-4)29(36-6)28(22)35-5/h7-16,18,20,25H,17,19,21H2,1-6H3,(H,32,33) |
| InChIKey | QTBNOSHEFQXRTQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |