C26H40O2Si2 — CID 122396412
triethyl-[oct-7-en-2-yloxy(diphenyl)silyl]oxysilane (PubChem CID 122396412) has the molecular formula C26H40O2Si2 and a molecular weight of 440.78 g/mol. Its IUPAC name is triethyl-[oct-7-en-2-yloxy(diphenyl)silyl]oxysilane.
| Compound Name | triethyl-[oct-7-en-2-yloxy(diphenyl)silyl]oxysilane |
|---|---|
| PubChem CID | 122396412 |
| Molecular Formula | C26H40O2Si2 |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | triethyl-[oct-7-en-2-yloxy(diphenyl)silyl]oxysilane |
| SMILES | C=CCCCCC(C)O[Si](O[Si](CC)(CC)CC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H40O2Si2/c1-6-10-11-14-19-24(5)27-30(25-20-15-12-16-21-25,26-22-17-13-18-23-26)28-29(7-2,8-3)9-4/h6,12-13,15-18,20-24H,1,7-11,14,19H2,2-5H3 |
| InChIKey | SRLCRQHZXWNWAN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|