C20H26O2Si — CID 91737874
pent-4-en-2-yloxy-diphenyl-propoxysilane (PubChem CID 91737874) has the molecular formula C20H26O2Si and a molecular weight of 326.51 g/mol. Its IUPAC name is pent-4-en-2-yloxy-diphenyl-propoxysilane.
| Compound Name | pent-4-en-2-yloxy-diphenyl-propoxysilane |
|---|---|
| PubChem CID | 91737874 |
| Molecular Formula | C20H26O2Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | pent-4-en-2-yloxy-diphenyl-propoxysilane |
| SMILES | C=CCC(C)O[Si](OCCC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26O2Si/c1-4-12-18(3)22-23(21-17-5-2,19-13-8-6-9-14-19)20-15-10-7-11-16-20/h4,6-11,13-16,18H,1,5,12,17H2,2-3H3 |
| InChIKey | ITAZAQBIFJXHJK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|