C25H36O2Si — CID 91742014
octoxy-pent-4-en-2-yloxy-diphenylsilane (PubChem CID 91742014) has the molecular formula C25H36O2Si and a molecular weight of 396.65 g/mol. Its IUPAC name is octoxy-pent-4-en-2-yloxy-diphenylsilane.
| Compound Name | octoxy-pent-4-en-2-yloxy-diphenylsilane |
|---|---|
| PubChem CID | 91742014 |
| Molecular Formula | C25H36O2Si |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | octoxy-pent-4-en-2-yloxy-diphenylsilane |
| SMILES | C=CCC(C)O[Si](OCCCCCCCC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H36O2Si/c1-4-6-7-8-9-16-22-26-28(27-23(3)17-5-2,24-18-12-10-13-19-24)25-20-14-11-15-21-25/h5,10-15,18-21,23H,2,4,6-9,16-17,22H2,1,3H3 |
| InChIKey | OQPWKXMPTTVSMT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|