C21H27F3O2Si — CID 91733110
hexoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane (PubChem CID 91733110) has the molecular formula C21H27F3O2Si and a molecular weight of 396.53 g/mol. Its IUPAC name is hexoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane.
| Compound Name | hexoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
|---|---|
| PubChem CID | 91733110 |
| Molecular Formula | C21H27F3O2Si |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | hexoxy-diphenyl-(1,1,1-trifluoropropan-2-yloxy)silane |
| SMILES | CCCCCCO[Si](OC(C)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27F3O2Si/c1-3-4-5-12-17-25-27(19-13-8-6-9-14-19,20-15-10-7-11-16-20)26-18(2)21(22,23)24/h6-11,13-16,18H,3-5,12,17H2,1-2H3 |
| InChIKey | SUDVKNQCTVSOBH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|