C25H32F6O2Si — CID 91733049
2,2,3,4,4,4-hexafluorobutoxy-nonoxy-diphenylsilane (PubChem CID 91733049) has the molecular formula C25H32F6O2Si and a molecular weight of 506.60 g/mol. Its IUPAC name is 2,2,3,4,4,4-hexafluorobutoxy-nonoxy-diphenylsilane.
| Compound Name | 2,2,3,4,4,4-hexafluorobutoxy-nonoxy-diphenylsilane |
|---|---|
| PubChem CID | 91733049 |
| Molecular Formula | C25H32F6O2Si |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 2,2,3,4,4,4-hexafluorobutoxy-nonoxy-diphenylsilane |
| SMILES | CCCCCCCCCO[Si](OCC(F)(F)C(F)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32F6O2Si/c1-2-3-4-5-6-7-14-19-32-34(21-15-10-8-11-16-21,22-17-12-9-13-18-22)33-20-24(27,28)23(26)25(29,30)31/h8-13,15-18,23H,2-7,14,19-20H2,1H3 |
| InChIKey | IPHDTVGNCWTHGC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|