C30H48O2Si — CID 91743177
decoxy-diphenyl-(2,4,4-trimethylpentoxy)silane (PubChem CID 91743177) has the molecular formula C30H48O2Si and a molecular weight of 468.80 g/mol. Its IUPAC name is decoxy-diphenyl-(2,4,4-trimethylpentoxy)silane.
| Compound Name | decoxy-diphenyl-(2,4,4-trimethylpentoxy)silane |
|---|---|
| PubChem CID | 91743177 |
| Molecular Formula | C30H48O2Si |
| Molecular Weight | 468.80 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | decoxy-diphenyl-(2,4,4-trimethylpentoxy)silane |
| SMILES | CCCCCCCCCCO[Si](OCC(C)CC(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H48O2Si/c1-6-7-8-9-10-11-12-19-24-31-33(28-20-15-13-16-21-28,29-22-17-14-18-23-29)32-26-27(2)25-30(3,4)5/h13-18,20-23,27H,6-12,19,24-26H2,1-5H3 |
| InChIKey | COBQTDWORQVEEG-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.80 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|