C28H30O5 — CID 15392032
methyl 3-[2-[1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxocyclohexyl]ethynyl]benzoate (PubChem CID 15392032) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is methyl 3-[2-[1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxocyclohexyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxocyclohexyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 15392032 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | methyl 3-[2-[1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxocyclohexyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#CC2(c3ccc(OC)c(OC4CCCC4)c3)CCC(=O)CC2)c1 |
| InChI | InChI=1S/C28H30O5/c1-31-25-11-10-22(19-26(25)33-24-8-3-4-9-24)28(16-13-23(29)14-17-28)15-12-20-6-5-7-21(18-20)27(30)32-2/h5-7,10-11,18-19,24H,3-4,8-9,13-14,16-17H2,1-2H3 |
| InChIKey | KKEFHSDGKPYUKL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|