C27H29NO3 — CID 54485703
3-[2-[1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxocyclohexyl]ethenyl]benzonitrile (PubChem CID 54485703) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is 3-[2-[1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxocyclohexyl]ethenyl]benzonitrile.
| Compound Name | 3-[2-[1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxocyclohexyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 54485703 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 3-[2-[1-(3-cyclopentyloxy-4-methoxyphenyl)-4-oxocyclohexyl]ethenyl]benzonitrile |
| SMILES | COc1ccc(C2(C=Cc3cccc(C#N)c3)CCC(=O)CC2)cc1OC1CCCC1 |
| InChI | InChI=1S/C27H29NO3/c1-30-25-10-9-22(18-26(25)31-24-7-2-3-8-24)27(15-12-23(29)13-16-27)14-11-20-5-4-6-21(17-20)19-28/h4-6,9-11,14,17-18,24H,2-3,7-8,12-13,15-16H2,1H3 |
| InChIKey | XSDNYFRALCNYCN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |