C27H26N2O4 — CID 59179032
3-[N-[(3-cyanophenyl)methyl]-3-cyclopentyloxy-4-methoxyanilino]benzoic acid (PubChem CID 59179032) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[N-[(3-cyanophenyl)methyl]-3-cyclopentyloxy-4-methoxyanilino]benzoic acid.
| Compound Name | 3-[N-[(3-cyanophenyl)methyl]-3-cyclopentyloxy-4-methoxyanilino]benzoic acid |
|---|---|
| PubChem CID | 59179032 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-[N-[(3-cyanophenyl)methyl]-3-cyclopentyloxy-4-methoxyanilino]benzoic acid |
| SMILES | COc1ccc(N(Cc2cccc(C#N)c2)c2cccc(C(=O)O)c2)cc1OC1CCCC1 |
| InChI | InChI=1S/C27H26N2O4/c1-32-25-13-12-23(16-26(25)33-24-10-2-3-11-24)29(18-20-7-4-6-19(14-20)17-28)22-9-5-8-21(15-22)27(30)31/h4-9,12-16,24H,2-3,10-11,18H2,1H3,(H,30,31) |
| InChIKey | BTMCPTUQMLPQEZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |