C20H24N4O3S — CID 18432846
8-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-3-ethyl-6-sulfanylidene-7H-purin-2-one (PubChem CID 18432846) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 8-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-3-ethyl-6-sulfanylidene-7H-purin-2-one.
| Compound Name | 8-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-3-ethyl-6-sulfanylidene-7H-purin-2-one |
|---|---|
| PubChem CID | 18432846 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 8-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-3-ethyl-6-sulfanylidene-7H-purin-2-one |
| SMILES | CCn1c(=O)[nH]c(=S)c2[nH]c(Cc3ccc(OC)c(OC4CCCC4)c3)nc21 |
| InChI | InChI=1S/C20H24N4O3S/c1-3-24-18-17(19(28)23-20(24)25)21-16(22-18)11-12-8-9-14(26-2)15(10-12)27-13-6-4-5-7-13/h8-10,13H,3-7,11H2,1-2H3,(H,21,22)(H,23,25,28) |
| InChIKey | FPLSUXQNHGSLEX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|