C17H20N4O4S — CID 18473505
6-amino-1-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-5-nitroso-2-sulfanylidenepyrimidin-4-one (PubChem CID 18473505) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is 6-amino-1-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-5-nitroso-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 6-amino-1-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-5-nitroso-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 18473505 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 6-amino-1-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-5-nitroso-2-sulfanylidenepyrimidin-4-one |
| SMILES | COc1ccc(Cn2c(N)c(N=O)c(=O)[nH]c2=S)cc1OC1CCCC1 |
| InChI | InChI=1S/C17H20N4O4S/c1-24-12-7-6-10(8-13(12)25-11-4-2-3-5-11)9-21-15(18)14(20-23)16(22)19-17(21)26/h6-8,11H,2-5,9,18H2,1H3,(H,19,22,26) |
| InChIKey | XBVBOWTWCSOKLK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|