C20H25N5O2S — CID 18473646
3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-(ethylamino)-7H-purine-2-thione (PubChem CID 18473646) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-(ethylamino)-7H-purine-2-thione.
| Compound Name | 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-(ethylamino)-7H-purine-2-thione |
|---|---|
| PubChem CID | 18473646 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-(ethylamino)-7H-purine-2-thione |
| SMILES | CCNc1nc(=S)n(Cc2ccc(OC)c(OC3CCCC3)c2)c2nc[nH]c12 |
| InChI | InChI=1S/C20H25N5O2S/c1-3-21-18-17-19(23-12-22-17)25(20(28)24-18)11-13-8-9-15(26-2)16(10-13)27-14-6-4-5-7-14/h8-10,12,14H,3-7,11H2,1-2H3,(H,22,23)(H,21,24,28) |
| InChIKey | LSRFRYXFTYQYBF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|