C23H32N5O3+ — CID 54167601
2-[3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-(ethylamino)-7H-purin-3-ium-8-yl]propan-2-ol (PubChem CID 54167601) has the molecular formula C23H32N5O3+ and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-[3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-(ethylamino)-7H-purin-3-ium-8-yl]propan-2-ol.
| Compound Name | 2-[3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-(ethylamino)-7H-purin-3-ium-8-yl]propan-2-ol |
|---|---|
| PubChem CID | 54167601 |
| Molecular Formula | C23H32N5O3+ |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 2-[3-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-6-(ethylamino)-7H-purin-3-ium-8-yl]propan-2-ol |
| SMILES | CCNc1nc[n+](Cc2ccc(OC)c(OC3CCCC3)c2)c2nc(C(C)(C)O)[nH]c12 |
| InChI | InChI=1S/C23H31N5O3/c1-5-24-20-19-21(27-22(26-19)23(2,3)29)28(14-25-20)13-15-10-11-17(30-4)18(12-15)31-16-8-6-7-9-16/h10-12,14,16,29H,5-9,13H2,1-4H3,(H,24,26,27)/p+1 |
| InChIKey | KEECGEZSERNPHN-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|