C23H32ClN3O3 — CID 142661692
N'-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-4-(ethylamino)-N-methylbenzohydrazide;hydrochloride (PubChem CID 142661692) has the molecular formula C23H32ClN3O3 and a molecular weight of 433.98 g/mol. Its IUPAC name is N'-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-4-(ethylamino)-N-methylbenzohydrazide;hydrochloride.
| Compound Name | N'-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-4-(ethylamino)-N-methylbenzohydrazide;hydrochloride |
|---|---|
| PubChem CID | 142661692 |
| Molecular Formula | C23H32ClN3O3 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N'-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-4-(ethylamino)-N-methylbenzohydrazide;hydrochloride |
| SMILES | CCNc1ccc(C(=O)N(C)NCc2ccc(OC)c(OC3CCCC3)c2)cc1.Cl |
| InChI | InChI=1S/C23H31N3O3.ClH/c1-4-24-19-12-10-18(11-13-19)23(27)26(2)25-16-17-9-14-21(28-3)22(15-17)29-20-7-5-6-8-20;/h9-15,20,24-25H,4-8,16H2,1-3H3;1H |
| InChIKey | PTOBSFPUYCCEKC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|