C33H41N3O5 — CID 142661708
N-[4-[[(3-cyclopentyloxy-4-methoxyphenyl)methyl-ethylamino]-methylcarbamoyl]phenyl]-N-ethyl-4-methoxybenzamide (PubChem CID 142661708) has the molecular formula C33H41N3O5 and a molecular weight of 559.71 g/mol. Its IUPAC name is N-[4-[[(3-cyclopentyloxy-4-methoxyphenyl)methyl-ethylamino]-methylcarbamoyl]phenyl]-N-ethyl-4-methoxybenzamide.
| Compound Name | N-[4-[[(3-cyclopentyloxy-4-methoxyphenyl)methyl-ethylamino]-methylcarbamoyl]phenyl]-N-ethyl-4-methoxybenzamide |
|---|---|
| PubChem CID | 142661708 |
| Molecular Formula | C33H41N3O5 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | N-[4-[[(3-cyclopentyloxy-4-methoxyphenyl)methyl-ethylamino]-methylcarbamoyl]phenyl]-N-ethyl-4-methoxybenzamide |
| SMILES | CCN(C(=O)c1ccc(OC)cc1)c1ccc(C(=O)N(C)N(CC)Cc2ccc(OC)c(OC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C33H41N3O5/c1-6-35(23-24-12-21-30(40-5)31(22-24)41-29-10-8-9-11-29)34(3)32(37)25-13-17-27(18-14-25)36(7-2)33(38)26-15-19-28(39-4)20-16-26/h12-22,29H,6-11,23H2,1-5H3 |
| InChIKey | OTQIBAFMNDYTNI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|